C15H18Cl2N2O3 — CID 112990888
N-cyclopentyl-2-[[2-(2,4-dichlorophenoxy)acetyl]amino]acetamide (PubChem CID 112990888) has the molecular formula C15H18Cl2N2O3 and a molecular weight of 345.23 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-(2,4-dichlorophenoxy)acetyl]amino]acetamide.
| Compound Name | N-cyclopentyl-2-[[2-(2,4-dichlorophenoxy)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 112990888 |
| Molecular Formula | C15H18Cl2N2O3 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-cyclopentyl-2-[[2-(2,4-dichlorophenoxy)acetyl]amino]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H18Cl2N2O3/c16-10-5-6-13(12(17)7-10)22-9-15(21)18-8-14(20)19-11-3-1-2-4-11/h5-7,11H,1-4,8-9H2,(H,18,21)(H,19,20) |
| InChIKey | DRSFVZIRDKDIOL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |