C11H11ClN2O3S2 — CID 80704039
4-chloro-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]benzonitrile (PubChem CID 80704039) has the molecular formula C11H11ClN2O3S2 and a molecular weight of 318.81 g/mol. Its IUPAC name is 4-chloro-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]benzonitrile.
| Compound Name | 4-chloro-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 80704039 |
| Molecular Formula | C11H11ClN2O3S2 |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 4-chloro-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]benzonitrile |
| SMILES | N#Cc1ccc(Cl)c(S(=O)(=O)N2CCS(=O)CC2)c1 |
| InChI | InChI=1S/C11H11ClN2O3S2/c12-10-2-1-9(8-13)7-11(10)19(16,17)14-3-5-18(15)6-4-14/h1-2,7H,3-6H2 |
| InChIKey | VYXJRTFKEWJPSR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |