C12H13ClN2O3S — CID 103533540
4-chloro-3-(3-methoxypyrrolidin-1-yl)sulfonylbenzonitrile (PubChem CID 103533540) has the molecular formula C12H13ClN2O3S and a molecular weight of 300.77 g/mol. Its IUPAC name is 4-chloro-3-(3-methoxypyrrolidin-1-yl)sulfonylbenzonitrile.
| Compound Name | 4-chloro-3-(3-methoxypyrrolidin-1-yl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 103533540 |
| Molecular Formula | C12H13ClN2O3S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 4-chloro-3-(3-methoxypyrrolidin-1-yl)sulfonylbenzonitrile |
| SMILES | COC1CCN(S(=O)(=O)c2cc(C#N)ccc2Cl)C1 |
| InChI | InChI=1S/C12H13ClN2O3S/c1-18-10-4-5-15(8-10)19(16,17)12-6-9(7-14)2-3-11(12)13/h2-3,6,10H,4-5,8H2,1H3 |
| InChIKey | WVOJPMJAVVQSKH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |