C14H20ClN3O4S — CID 120893957
5-chloro-2-methoxy-N,N-dimethyl-3-piperazin-1-ylsulfonylbenzamide (PubChem CID 120893957) has the molecular formula C14H20ClN3O4S and a molecular weight of 361.85 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N,N-dimethyl-3-piperazin-1-ylsulfonylbenzamide.
| Compound Name | 5-chloro-2-methoxy-N,N-dimethyl-3-piperazin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 120893957 |
| Molecular Formula | C14H20ClN3O4S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 5-chloro-2-methoxy-N,N-dimethyl-3-piperazin-1-ylsulfonylbenzamide |
| SMILES | COc1c(C(=O)N(C)C)cc(Cl)cc1S(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C14H20ClN3O4S/c1-17(2)14(19)11-8-10(15)9-12(13(11)22-3)23(20,21)18-6-4-16-5-7-18/h8-9,16H,4-7H2,1-3H3 |
| InChIKey | GQCZFFHMLOEZOH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |