C17H18N4O7S — CID 59260842
1-[2-(5-methyl-2-nitrophenoxy)-5-nitrophenyl]sulfonylpiperazine (PubChem CID 59260842) has the molecular formula C17H18N4O7S and a molecular weight of 422.42 g/mol. Its IUPAC name is 1-[2-(5-methyl-2-nitrophenoxy)-5-nitrophenyl]sulfonylpiperazine.
| Compound Name | 1-[2-(5-methyl-2-nitrophenoxy)-5-nitrophenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 59260842 |
| Molecular Formula | C17H18N4O7S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 1-[2-(5-methyl-2-nitrophenoxy)-5-nitrophenyl]sulfonylpiperazine |
| SMILES | Cc1ccc([N+](=O)[O-])c(Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C17H18N4O7S/c1-12-2-4-14(21(24)25)16(10-12)28-15-5-3-13(20(22)23)11-17(15)29(26,27)19-8-6-18-7-9-19/h2-5,10-11,18H,6-9H2,1H3 |
| InChIKey | XTXWURBRDIOANV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|