C26H24F3N3O6S — CID 68516324
[4-[2-(2,5-dimethylphenoxy)-5-nitrophenyl]sulfonylpiperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 68516324) has the molecular formula C26H24F3N3O6S and a molecular weight of 563.55 g/mol. Its IUPAC name is [4-[2-(2,5-dimethylphenoxy)-5-nitrophenyl]sulfonylpiperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-[2-(2,5-dimethylphenoxy)-5-nitrophenyl]sulfonylpiperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 68516324 |
| Molecular Formula | C26H24F3N3O6S |
| Molecular Weight | 563.55 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | [4-[2-(2,5-dimethylphenoxy)-5-nitrophenyl]sulfonylpiperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1ccc(C)c(Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCN(C(=O)c3ccc(C(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C26H24F3N3O6S/c1-17-3-4-18(2)23(15-17)38-22-10-9-21(32(34)35)16-24(22)39(36,37)31-13-11-30(12-14-31)25(33)19-5-7-20(8-6-19)26(27,28)29/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | SMUGVTPAXBILFS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|