C19H18F3N3O5S — CID 38117950
[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 38117950) has the molecular formula C19H18F3N3O5S and a molecular weight of 457.43 g/mol. Its IUPAC name is [4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 38117950 |
| Molecular Formula | C19H18F3N3O5S |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | [4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCN(C(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H18F3N3O5S/c1-13-6-7-14(25(27)28)12-17(13)31(29,30)24-10-8-23(9-11-24)18(26)15-4-2-3-5-16(15)19(20,21)22/h2-7,12H,8-11H2,1H3 |
| InChIKey | CZQVTWOJMVBOHX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|