C15H24N2O4S — CID 110758690
1-(2,4-dimethoxy-3-methylphenyl)sulfonyl-4-ethylpiperazine (PubChem CID 110758690) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is 1-(2,4-dimethoxy-3-methylphenyl)sulfonyl-4-ethylpiperazine.
| Compound Name | 1-(2,4-dimethoxy-3-methylphenyl)sulfonyl-4-ethylpiperazine |
|---|---|
| PubChem CID | 110758690 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-(2,4-dimethoxy-3-methylphenyl)sulfonyl-4-ethylpiperazine |
| SMILES | CCN1CCN(S(=O)(=O)c2ccc(OC)c(C)c2OC)CC1 |
| InChI | InChI=1S/C15H24N2O4S/c1-5-16-8-10-17(11-9-16)22(18,19)14-7-6-13(20-3)12(2)15(14)21-4/h6-7H,5,8-11H2,1-4H3 |
| InChIKey | TVNWZUYQYGTJGM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |