C14H20N2O5S — CID 110758691
4-(2,4-dimethoxy-3-methylphenyl)sulfonylpiperazine-1-carbaldehyde (PubChem CID 110758691) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is 4-(2,4-dimethoxy-3-methylphenyl)sulfonylpiperazine-1-carbaldehyde.
| Compound Name | 4-(2,4-dimethoxy-3-methylphenyl)sulfonylpiperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 110758691 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 4-(2,4-dimethoxy-3-methylphenyl)sulfonylpiperazine-1-carbaldehyde |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C=O)CC2)c(OC)c1C |
| InChI | InChI=1S/C14H20N2O5S/c1-11-12(20-2)4-5-13(14(11)21-3)22(18,19)16-8-6-15(10-17)7-9-16/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | QRBFXSHQCLCDMR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|