C17H23N3O7S2 — CID 21005548
4-[5-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]sulfonylpiperazine-1-carbaldehyde (PubChem CID 21005548) has the molecular formula C17H23N3O7S2 and a molecular weight of 445.52 g/mol. Its IUPAC name is 4-[5-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]sulfonylpiperazine-1-carbaldehyde.
| Compound Name | 4-[5-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]sulfonylpiperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 21005548 |
| Molecular Formula | C17H23N3O7S2 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 4-[5-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]sulfonylpiperazine-1-carbaldehyde |
| SMILES | COc1ccc(N2C(=O)C(C)(C)CS2(=O)=O)cc1S(=O)(=O)N1CCN(C=O)CC1 |
| InChI | InChI=1S/C17H23N3O7S2/c1-17(2)11-28(23,24)20(16(17)22)13-4-5-14(27-3)15(10-13)29(25,26)19-8-6-18(12-21)7-9-19/h4-5,10,12H,6-9,11H2,1-3H3 |
| InChIKey | FDBCZZNWXMWFSW-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 121.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|