C19H28N2O6S2 — CID 21005559
2-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-methoxyphenyl]-4,4-dimethyl-1,1-dioxo-1,2-thiazolidin-3-one (PubChem CID 21005559) has the molecular formula C19H28N2O6S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-methoxyphenyl]-4,4-dimethyl-1,1-dioxo-1,2-thiazolidin-3-one.
| Compound Name | 2-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-methoxyphenyl]-4,4-dimethyl-1,1-dioxo-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 21005559 |
| Molecular Formula | C19H28N2O6S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 2-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-4-methoxyphenyl]-4,4-dimethyl-1,1-dioxo-1,2-thiazolidin-3-one |
| SMILES | COc1ccc(N2C(=O)C(C)(C)CS2(=O)=O)cc1S(=O)(=O)N1[C@H](C)CCC[C@@H]1C |
| InChI | InChI=1S/C19H28N2O6S2/c1-13-7-6-8-14(2)20(13)29(25,26)17-11-15(9-10-16(17)27-5)21-18(22)19(3,4)12-28(21,23)24/h9-11,13-14H,6-8,12H2,1-5H3/t13-,14+ |
| InChIKey | OOYPIOQGTGWCHL-OKILXGFUSA-N |
| XLogP | 2.35 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |