C24H31N3O4S — CID 89020166
1-cyclohexyl-4-[2-(2,5-dimethylphenoxy)-5-nitrosophenyl]sulfonylpiperazine (PubChem CID 89020166) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is 1-cyclohexyl-4-[2-(2,5-dimethylphenoxy)-5-nitrosophenyl]sulfonylpiperazine.
| Compound Name | 1-cyclohexyl-4-[2-(2,5-dimethylphenoxy)-5-nitrosophenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 89020166 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 1-cyclohexyl-4-[2-(2,5-dimethylphenoxy)-5-nitrosophenyl]sulfonylpiperazine |
| SMILES | Cc1ccc(C)c(Oc2ccc(N=O)cc2S(=O)(=O)N2CCN(C3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C24H31N3O4S/c1-18-8-9-19(2)23(16-18)31-22-11-10-20(25-28)17-24(22)32(29,30)27-14-12-26(13-15-27)21-6-4-3-5-7-21/h8-11,16-17,21H,3-7,12-15H2,1-2H3 |
| InChIKey | MQLNYVGAKQTGNI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |