C14H24N2O4S — CID 102945892
5-amino-N-ethyl-2,4-dimethoxy-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 102945892) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is 5-amino-N-ethyl-2,4-dimethoxy-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 5-amino-N-ethyl-2,4-dimethoxy-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102945892 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 5-amino-N-ethyl-2,4-dimethoxy-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CCN(CC(C)C)S(=O)(=O)c1cc(N)c(OC)cc1OC |
| InChI | InChI=1S/C14H24N2O4S/c1-6-16(9-10(2)3)21(17,18)14-7-11(15)12(19-4)8-13(14)20-5/h7-8,10H,6,9,15H2,1-5H3 |
| InChIKey | NGSIORRKVMXHIA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|