C11H11BrN4O3S — CID 81413836
5-amino-4-bromo-N,N-bis(cyanomethyl)-2-methoxybenzenesulfonamide (PubChem CID 81413836) has the molecular formula C11H11BrN4O3S and a molecular weight of 359.21 g/mol. Its IUPAC name is 5-amino-4-bromo-N,N-bis(cyanomethyl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-amino-4-bromo-N,N-bis(cyanomethyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 81413836 |
| Molecular Formula | C11H11BrN4O3S |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 5-amino-4-bromo-N,N-bis(cyanomethyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1cc(Br)c(N)cc1S(=O)(=O)N(CC#N)CC#N |
| InChI | InChI=1S/C11H11BrN4O3S/c1-19-10-6-8(12)9(15)7-11(10)20(17,18)16(4-2-13)5-3-14/h6-7H,4-5,15H2,1H3 |
| InChIKey | NIALCGUZCDSEHR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|