About N,N-diethyl-4-methoxy-2,6-dimethylbenzenesulfonamide
N,N-diethyl-4-methoxy-2,6-dimethylbenzenesulfonamide (PubChem CID 60754894) has the molecular formula C13H21NO3S
and a molecular weight of 271.38 g/mol. Its IUPAC name is N,N-diethyl-4-methoxy-2,6-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | N,N-diethyl-4-methoxy-2,6-dimethylbenzenesulfonamide |
| PubChem CID | 60754894 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N,N-diethyl-4-methoxy-2,6-dimethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1c(C)cc(OC)cc1C |
| InChI | InChI=1S/C13H21NO3S/c1-6-14(7-2)18(15,16)13-10(3)8-12(17-5)9-11(13)4/h8-9H,6-7H2,1-5H3 |
| InChIKey | XSFLHPRMRAGYDC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-4-methoxy-2,6-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4-methoxy-2,6-dimethylbenzenesulfonamide?
The IUPAC name of N,N-diethyl-4-methoxy-2,6-dimethylbenzenesulfonamide (CID 60754894) is N,N-diethyl-4-methoxy-2,6-dimethylbenzenesulfonamide.
What is the SMILES notation for N,N-diethyl-4-methoxy-2,6-dimethylbenzenesulfonamide?
The canonical SMILES for N,N-diethyl-4-methoxy-2,6-dimethylbenzenesulfonamide is CCN(CC)S(=O)(=O)c1c(C)cc(OC)cc1C.
What is the InChIKey of N,N-diethyl-4-methoxy-2,6-dimethylbenzenesulfonamide?
The InChIKey is XSFLHPRMRAGYDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO3S/c1-6-14(7-2)18(15,16)13-10(3)8-12(17-5)9-11(13)4/h8-9H,6-7H2,1-5H3.
What are the key properties of N,N-diethyl-4-methoxy-2,6-dimethylbenzenesulfonamide?
N,N-diethyl-4-methoxy-2,6-dimethylbenzenesulfonamide has a molecular weight of 271.38 g/mol, XLogP of 2.34, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4-methoxy-2,6-dimethylbenzenesulfonamide is sourced from PubChem (CID 60754894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).