C21H42N2O5S — CID 143534378
N-[2-(dimethylamino)ethyl]-N-[2-(2-hydroxyethoxy)ethyl]-4-methoxy-2,6-dimethylbenzenesulfonamide;ethane (PubChem CID 143534378) has the molecular formula C21H42N2O5S and a molecular weight of 434.64 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-[2-(2-hydroxyethoxy)ethyl]-4-methoxy-2,6-dimethylbenzenesulfonamide;ethane.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-[2-(2-hydroxyethoxy)ethyl]-4-methoxy-2,6-dimethylbenzenesulfonamide;ethane |
|---|---|
| PubChem CID | 143534378 |
| Molecular Formula | C21H42N2O5S |
| Molecular Weight | 434.64 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-[2-(2-hydroxyethoxy)ethyl]-4-methoxy-2,6-dimethylbenzenesulfonamide;ethane |
| SMILES | CC.CC.COc1cc(C)c(S(=O)(=O)N(CCOCCO)CCN(C)C)c(C)c1 |
| InChI | InChI=1S/C17H30N2O5S.2C2H6/c1-14-12-16(23-5)13-15(2)17(14)25(21,22)19(7-6-18(3)4)8-10-24-11-9-20;2*1-2/h12-13,20H,6-11H2,1-5H3;2*1-2H3 |
| InChIKey | SKMACXPYDGZCDW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.64 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|