C14H20BrNO5S — CID 147385198
2-[2-[(4-bromo-2,6-dimethylphenyl)sulfonyl-ethylamino]ethoxy]acetic acid (PubChem CID 147385198) has the molecular formula C14H20BrNO5S and a molecular weight of 394.29 g/mol. Its IUPAC name is 2-[2-[(4-bromo-2,6-dimethylphenyl)sulfonyl-ethylamino]ethoxy]acetic acid.
| Compound Name | 2-[2-[(4-bromo-2,6-dimethylphenyl)sulfonyl-ethylamino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 147385198 |
| Molecular Formula | C14H20BrNO5S |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 2-[2-[(4-bromo-2,6-dimethylphenyl)sulfonyl-ethylamino]ethoxy]acetic acid |
| SMILES | CCN(CCOCC(=O)O)S(=O)(=O)c1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C14H20BrNO5S/c1-4-16(5-6-21-9-13(17)18)22(19,20)14-10(2)7-12(15)8-11(14)3/h7-8H,4-6,9H2,1-3H3,(H,17,18) |
| InChIKey | DLTKQUTXVNLLGM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|