C12H17Br2NO3S — CID 114263617
4-bromo-N-[2-(2-bromoethoxy)ethyl]-N-ethylbenzenesulfonamide (PubChem CID 114263617) has the molecular formula C12H17Br2NO3S and a molecular weight of 415.15 g/mol. Its IUPAC name is 4-bromo-N-[2-(2-bromoethoxy)ethyl]-N-ethylbenzenesulfonamide.
| Compound Name | 4-bromo-N-[2-(2-bromoethoxy)ethyl]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 114263617 |
| Molecular Formula | C12H17Br2NO3S |
| Molecular Weight | 415.15 g/mol |
| Exact Mass | 412.93 |
| IUPAC Name | 4-bromo-N-[2-(2-bromoethoxy)ethyl]-N-ethylbenzenesulfonamide |
| SMILES | CCN(CCOCCBr)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H17Br2NO3S/c1-2-15(8-10-18-9-7-13)19(16,17)12-5-3-11(14)4-6-12/h3-6H,2,7-10H2,1H3 |
| InChIKey | MDOQOGJTSDLLFP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.15 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|