C13H20N2O3S2 — CID 63690581
4-[2-ethoxyethyl(ethyl)sulfamoyl]benzenecarbothioamide (PubChem CID 63690581) has the molecular formula C13H20N2O3S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 4-[2-ethoxyethyl(ethyl)sulfamoyl]benzenecarbothioamide.
| Compound Name | 4-[2-ethoxyethyl(ethyl)sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 63690581 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-[2-ethoxyethyl(ethyl)sulfamoyl]benzenecarbothioamide |
| SMILES | CCOCCN(CC)S(=O)(=O)c1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C13H20N2O3S2/c1-3-15(9-10-18-4-2)20(16,17)12-7-5-11(6-8-12)13(14)19/h5-8H,3-4,9-10H2,1-2H3,(H2,14,19) |
| InChIKey | BVHUJJLWIPCJCS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|