C15H22N2O4S — CID 3821573
4-cyano-N,N-bis(2-ethoxyethyl)benzenesulfonamide (PubChem CID 3821573) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-cyano-N,N-bis(2-ethoxyethyl)benzenesulfonamide.
| Compound Name | 4-cyano-N,N-bis(2-ethoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3821573 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 4-cyano-N,N-bis(2-ethoxyethyl)benzenesulfonamide |
| SMILES | CCOCCN(CCOCC)S(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H22N2O4S/c1-3-20-11-9-17(10-12-21-4-2)22(18,19)15-7-5-14(13-16)6-8-15/h5-8H,3-4,9-12H2,1-2H3 |
| InChIKey | JHZQHRIOMOJCLI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|