C14H19N3O3S — CID 61060009
2-[(4-cyanophenyl)sulfonyl-propylamino]-N,N-dimethylacetamide (PubChem CID 61060009) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)sulfonyl-propylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[(4-cyanophenyl)sulfonyl-propylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 61060009 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[(4-cyanophenyl)sulfonyl-propylamino]-N,N-dimethylacetamide |
| SMILES | CCCN(CC(=O)N(C)C)S(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H19N3O3S/c1-4-9-17(11-14(18)16(2)3)21(19,20)13-7-5-12(10-15)6-8-13/h5-8H,4,9,11H2,1-3H3 |
| InChIKey | XVRUAXVKSZSOGJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |