C10H14N2O3S2 — CID 54879331
4-[2-hydroxyethyl(methyl)sulfamoyl]benzenecarbothioamide (PubChem CID 54879331) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 4-[2-hydroxyethyl(methyl)sulfamoyl]benzenecarbothioamide.
| Compound Name | 4-[2-hydroxyethyl(methyl)sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 54879331 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 4-[2-hydroxyethyl(methyl)sulfamoyl]benzenecarbothioamide |
| SMILES | CN(CCO)S(=O)(=O)c1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C10H14N2O3S2/c1-12(6-7-13)17(14,15)9-4-2-8(3-5-9)10(11)16/h2-5,13H,6-7H2,1H3,(H2,11,16) |
| InChIKey | CHLNPLSWCFHWHV-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|