C19H33NO6S2 — CID 143873788
2-[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]ethoxy]acetic acid;ethane;methanethiol (PubChem CID 143873788) has the molecular formula C19H33NO6S2 and a molecular weight of 435.61 g/mol. Its IUPAC name is 2-[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]ethoxy]acetic acid;ethane;methanethiol.
| Compound Name | 2-[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]ethoxy]acetic acid;ethane;methanethiol |
|---|---|
| PubChem CID | 143873788 |
| Molecular Formula | C19H33NO6S2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]ethoxy]acetic acid;ethane;methanethiol |
| SMILES | CC.COc1cc(C)c(S(=O)(=O)N(CCOCC(=O)O)C2CC2)c(C)c1.CS |
| InChI | InChI=1S/C16H23NO6S.C2H6.CH4S/c1-11-8-14(22-3)9-12(2)16(11)24(20,21)17(13-4-5-13)6-7-23-10-15(18)19;2*1-2/h8-9,13H,4-7,10H2,1-3H3,(H,18,19);1-2H3;2H,1H3 |
| InChIKey | KVMBGSWBTOMMGD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|