C15H23NO6S — CID 59820094
3-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]propanoic acid (PubChem CID 59820094) has the molecular formula C15H23NO6S and a molecular weight of 345.42 g/mol. Its IUPAC name is 3-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]propanoic acid.
| Compound Name | 3-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 59820094 |
| Molecular Formula | C15H23NO6S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 3-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]propanoic acid |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCOCCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C15H23NO6S/c1-11-9-13(21-4)10-12(2)15(11)23(19,20)16(3)6-8-22-7-5-14(17)18/h9-10H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | PEUCDPKMPQWQRQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|