C22H36N2O5S — CID 68643504
N-(cyclohexylmethyl)-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]-N-methylacetamide (PubChem CID 68643504) has the molecular formula C22H36N2O5S and a molecular weight of 440.61 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]-N-methylacetamide.
| Compound Name | N-(cyclohexylmethyl)-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 68643504 |
| Molecular Formula | C22H36N2O5S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | N-(cyclohexylmethyl)-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]-N-methylacetamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCOCC(=O)N(C)CC2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C22H36N2O5S/c1-17-13-20(28-5)14-18(2)22(17)30(26,27)24(4)11-12-29-16-21(25)23(3)15-19-9-7-6-8-10-19/h13-14,19H,6-12,15-16H2,1-5H3 |
| InChIKey | XXLJIDXUMJZGND-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|