C27H41IN4O5S — CID 162339691
2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]-N-methyl-N-[[1-(1-methylpyridin-1-ium-4-yl)piperidin-4-yl]methyl]acetamide iodide (PubChem CID 162339691) has the molecular formula C27H41IN4O5S and a molecular weight of 660.62 g/mol. Its IUPAC name is 2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]-N-methyl-N-[[1-(1-methylpyridin-1-ium-4-yl)piperidin-4-yl]methyl]acetamide iodide.
| Compound Name | 2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]-N-methyl-N-[[1-(1-methylpyridin-1-ium-4-yl)piperidin-4-yl]methyl]acetamide iodide |
|---|---|
| PubChem CID | 162339691 |
| Molecular Formula | C27H41IN4O5S |
| Molecular Weight | 660.62 g/mol |
| Exact Mass | 660.18 |
| IUPAC Name | 2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]-N-methyl-N-[[1-(1-methylpyridin-1-ium-4-yl)piperidin-4-yl]methyl]acetamide iodide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCOCC(=O)N(C)CC2CCN(c3cc[n+](C)cc3)CC2)c(C)c1.[I-] |
| InChI | InChI=1S/C27H41N4O5S.HI/c1-21-17-25(35-6)18-22(2)27(21)37(33,34)30(5)15-16-36-20-26(32)29(4)19-23-7-13-31(14-8-23)24-9-11-28(3)12-10-24;/h9-12,17-18,23H,7-8,13-16,19-20H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | RYYZPGPAGLBHHK-UHFFFAOYSA-M |
| XLogP | -0.85 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.62 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|