C21H32N2O6S — CID 59820135
N-[2-[2-(4-ethenyl-4-hydroxypiperidin-1-yl)-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide (PubChem CID 59820135) has the molecular formula C21H32N2O6S and a molecular weight of 440.56 g/mol. Its IUPAC name is N-[2-[2-(4-ethenyl-4-hydroxypiperidin-1-yl)-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide.
| Compound Name | N-[2-[2-(4-ethenyl-4-hydroxypiperidin-1-yl)-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 59820135 |
| Molecular Formula | C21H32N2O6S |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N-[2-[2-(4-ethenyl-4-hydroxypiperidin-1-yl)-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide |
| SMILES | C=CC1(O)CCN(C(=O)COCCN(C)S(=O)(=O)c2c(C)cc(OC)cc2C)CC1 |
| InChI | InChI=1S/C21H32N2O6S/c1-6-21(25)7-9-23(10-8-21)19(24)15-29-12-11-22(4)30(26,27)20-16(2)13-18(28-5)14-17(20)3/h6,13-14,25H,1,7-12,15H2,2-5H3 |
| InChIKey | WETXNHZFLXJDFP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|