C25H38N4O5S — CID 23654888
N-[2-[2-[9-(cyanomethyl)-3,9-diazaspiro[5.5]undecan-3-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide (PubChem CID 23654888) has the molecular formula C25H38N4O5S and a molecular weight of 506.67 g/mol. Its IUPAC name is N-[2-[2-[9-(cyanomethyl)-3,9-diazaspiro[5.5]undecan-3-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide.
| Compound Name | N-[2-[2-[9-(cyanomethyl)-3,9-diazaspiro[5.5]undecan-3-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 23654888 |
| Molecular Formula | C25H38N4O5S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | N-[2-[2-[9-(cyanomethyl)-3,9-diazaspiro[5.5]undecan-3-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCOCC(=O)N2CCC3(CCN(CC#N)CC3)CC2)c(C)c1 |
| InChI | InChI=1S/C25H38N4O5S/c1-20-17-22(33-4)18-21(2)24(20)35(31,32)27(3)15-16-34-19-23(30)29-12-7-25(8-13-29)5-10-28(11-6-25)14-9-26/h17-18H,5-8,10-16,19H2,1-4H3 |
| InChIKey | KKVQOHQCQIMNLB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 103.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|