C26H41N5O6S — CID 25207034
N-[2-[2-[(3aR,6aS)-5-(4-methylpiperazine-1-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide (PubChem CID 25207034) has the molecular formula C26H41N5O6S and a molecular weight of 551.71 g/mol. Its IUPAC name is N-[2-[2-[(3aR,6aS)-5-(4-methylpiperazine-1-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide.
| Compound Name | N-[2-[2-[(3aR,6aS)-5-(4-methylpiperazine-1-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 25207034 |
| Molecular Formula | C26H41N5O6S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | N-[2-[2-[(3aR,6aS)-5-(4-methylpiperazine-1-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCOCC(=O)N2C[C@@H]3CN(C(=O)N4CCN(C)CC4)C[C@@H]3C2)c(C)c1 |
| InChI | InChI=1S/C26H41N5O6S/c1-19-12-23(36-5)13-20(2)25(19)38(34,35)28(4)10-11-37-18-24(32)30-14-21-16-31(17-22(21)15-30)26(33)29-8-6-27(3)7-9-29/h12-13,21-22H,6-11,14-18H2,1-5H3/t21-,22+ |
| InChIKey | JVMHRJRWPWUGQM-SZPZYZBQSA-N |
| XLogP | 0.71 |
| TPSA | 102.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|