C26H43N5O5S — CID 143858305
N-[2-[2-[4-(2-iminoethyl)-4-(4-methylpiperazin-1-yl)piperidin-1-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide (PubChem CID 143858305) has the molecular formula C26H43N5O5S and a molecular weight of 537.73 g/mol. Its IUPAC name is N-[2-[2-[4-(2-iminoethyl)-4-(4-methylpiperazin-1-yl)piperidin-1-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide.
| Compound Name | N-[2-[2-[4-(2-iminoethyl)-4-(4-methylpiperazin-1-yl)piperidin-1-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 143858305 |
| Molecular Formula | C26H43N5O5S |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | N-[2-[2-[4-(2-iminoethyl)-4-(4-methylpiperazin-1-yl)piperidin-1-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide |
| SMILES | [H]/N=C/CC1(N2CCN(C)CC2)CCN(C(=O)COCCN(C)S(=O)(=O)c2c(C)cc(OC)cc2C)CC1 |
| InChI | InChI=1S/C26H43N5O5S/c1-21-18-23(35-5)19-22(2)25(21)37(33,34)29(4)16-17-36-20-24(32)30-10-7-26(6-9-27,8-11-30)31-14-12-28(3)13-15-31/h9,18-19,27H,6-8,10-17,20H2,1-5H3/b27-9+ |
| InChIKey | SCQPRZPTIOZXDZ-OXUBWTJQSA-N |
| XLogP | 1.60 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|