C27H45N3O6S — CID 24897510
1-[3-[2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]acetyl]-3-azaspiro[5.5]undecan-9-yl]-N,N-dimethylmethanamine oxide (PubChem CID 24897510) has the molecular formula C27H45N3O6S and a molecular weight of 539.74 g/mol. Its IUPAC name is 1-[3-[2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]acetyl]-3-azaspiro[5.5]undecan-9-yl]-N,N-dimethylmethanamine oxide.
| Compound Name | 1-[3-[2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]acetyl]-3-azaspiro[5.5]undecan-9-yl]-N,N-dimethylmethanamine oxide |
|---|---|
| PubChem CID | 24897510 |
| Molecular Formula | C27H45N3O6S |
| Molecular Weight | 539.74 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | 1-[3-[2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]acetyl]-3-azaspiro[5.5]undecan-9-yl]-N,N-dimethylmethanamine oxide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCOCC(=O)N2CCC3(CCC(C[N+](C)(C)[O-])CC3)CC2)c(C)c1 |
| InChI | InChI=1S/C27H45N3O6S/c1-21-17-24(35-6)18-22(2)26(21)37(33,34)28(3)15-16-36-20-25(31)29-13-11-27(12-14-29)9-7-23(8-10-27)19-30(4,5)32/h17-18,23H,7-16,19-20H2,1-6H3 |
| InChIKey | FHUWEOQXOVXJJH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.74 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|