C20H26N2O4S — CID 58116192
N-[4-(4-aminophenyl)-3-oxobutyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide (PubChem CID 58116192) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is N-[4-(4-aminophenyl)-3-oxobutyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide.
| Compound Name | N-[4-(4-aminophenyl)-3-oxobutyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 58116192 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[4-(4-aminophenyl)-3-oxobutyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCC(=O)Cc2ccc(N)cc2)c(C)c1 |
| InChI | InChI=1S/C20H26N2O4S/c1-14-11-19(26-4)12-15(2)20(14)27(24,25)22(3)10-9-18(23)13-16-5-7-17(21)8-6-16/h5-8,11-12H,9-10,13,21H2,1-4H3 |
| InChIKey | WDTPIPADRKKQSR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|