C26H37N3O4S — CID 58116179
4-methoxy-N,2,6-trimethyl-N-[4-[4-[4-(methylamino)piperidin-1-yl]phenyl]-3-oxobutyl]benzenesulfonamide (PubChem CID 58116179) has the molecular formula C26H37N3O4S and a molecular weight of 487.67 g/mol. Its IUPAC name is 4-methoxy-N,2,6-trimethyl-N-[4-[4-[4-(methylamino)piperidin-1-yl]phenyl]-3-oxobutyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N,2,6-trimethyl-N-[4-[4-[4-(methylamino)piperidin-1-yl]phenyl]-3-oxobutyl]benzenesulfonamide |
|---|---|
| PubChem CID | 58116179 |
| Molecular Formula | C26H37N3O4S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 4-methoxy-N,2,6-trimethyl-N-[4-[4-[4-(methylamino)piperidin-1-yl]phenyl]-3-oxobutyl]benzenesulfonamide |
| SMILES | CNC1CCN(c2ccc(CC(=O)CCN(C)S(=O)(=O)c3c(C)cc(OC)cc3C)cc2)CC1 |
| InChI | InChI=1S/C26H37N3O4S/c1-19-16-25(33-5)17-20(2)26(19)34(31,32)28(4)13-12-24(30)18-21-6-8-23(9-7-21)29-14-10-22(27-3)11-15-29/h6-9,16-17,22,27H,10-15,18H2,1-5H3 |
| InChIKey | NLDNFJPFIXWPRG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|