C26H37N3O4S — CID 58116140
N-[4-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3-oxobutyl]-4-methoxy-N,2-dimethylbenzenesulfonamide (PubChem CID 58116140) has the molecular formula C26H37N3O4S and a molecular weight of 487.67 g/mol. Its IUPAC name is N-[4-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3-oxobutyl]-4-methoxy-N,2-dimethylbenzenesulfonamide.
| Compound Name | N-[4-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3-oxobutyl]-4-methoxy-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 58116140 |
| Molecular Formula | C26H37N3O4S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | N-[4-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3-oxobutyl]-4-methoxy-N,2-dimethylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CCC(=O)Cc2ccc(N3CCC(N(C)C)CC3)cc2)c(C)c1 |
| InChI | InChI=1S/C26H37N3O4S/c1-20-18-25(33-5)10-11-26(20)34(31,32)28(4)15-14-24(30)19-21-6-8-23(9-7-21)29-16-12-22(13-17-29)27(2)3/h6-11,18,22H,12-17,19H2,1-5H3 |
| InChIKey | DFKUREMUOOCGTN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|