C27H40N4O5S — CID 143632519
N-[[4-[4-(dimethylamino)piperidin-1-yl]phenyl]methyl]-2-[2-[(4-methoxy-2-methylphenyl)sulfonyl-methylamino]ethoxy]acetamide (PubChem CID 143632519) has the molecular formula C27H40N4O5S and a molecular weight of 532.71 g/mol. Its IUPAC name is N-[[4-[4-(dimethylamino)piperidin-1-yl]phenyl]methyl]-2-[2-[(4-methoxy-2-methylphenyl)sulfonyl-methylamino]ethoxy]acetamide.
| Compound Name | N-[[4-[4-(dimethylamino)piperidin-1-yl]phenyl]methyl]-2-[2-[(4-methoxy-2-methylphenyl)sulfonyl-methylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 143632519 |
| Molecular Formula | C27H40N4O5S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | N-[[4-[4-(dimethylamino)piperidin-1-yl]phenyl]methyl]-2-[2-[(4-methoxy-2-methylphenyl)sulfonyl-methylamino]ethoxy]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CCOCC(=O)NCc2ccc(N3CCC(N(C)C)CC3)cc2)c(C)c1 |
| InChI | InChI=1S/C27H40N4O5S/c1-21-18-25(35-5)10-11-26(21)37(33,34)30(4)16-17-36-20-27(32)28-19-22-6-8-24(9-7-22)31-14-12-23(13-15-31)29(2)3/h6-11,18,23H,12-17,19-20H2,1-5H3,(H,28,32) |
| InChIKey | FGEXXWBOQDRQSB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|