C28H39N3O5S — CID 68778665
2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-pyrrolidin-2-ylmethoxy]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide (PubChem CID 68778665) has the molecular formula C28H39N3O5S and a molecular weight of 529.70 g/mol. Its IUPAC name is 2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-pyrrolidin-2-ylmethoxy]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide.
| Compound Name | 2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-pyrrolidin-2-ylmethoxy]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 68778665 |
| Molecular Formula | C28H39N3O5S |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | 2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-pyrrolidin-2-ylmethoxy]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
| SMILES | COc1cc(C)c(S(=O)(=O)C(OCC(=O)NCc2ccc(N3CCCCC3)cc2)C2CCCN2)c(C)c1 |
| InChI | InChI=1S/C28H39N3O5S/c1-20-16-24(35-3)17-21(2)27(20)37(33,34)28(25-8-7-13-29-25)36-19-26(32)30-18-22-9-11-23(12-10-22)31-14-5-4-6-15-31/h9-12,16-17,25,28-29H,4-8,13-15,18-19H2,1-3H3,(H,30,32) |
| InChIKey | QFMKYLPSSDXAHE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|