C20H26N2O4S — CID 94249243
4-methoxy-2,6-dimethyl-N-[(4-morpholin-4-ylphenyl)methyl]benzenesulfonamide (PubChem CID 94249243) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is 4-methoxy-2,6-dimethyl-N-[(4-morpholin-4-ylphenyl)methyl]benzenesulfonamide.
| Compound Name | 4-methoxy-2,6-dimethyl-N-[(4-morpholin-4-ylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 94249243 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 4-methoxy-2,6-dimethyl-N-[(4-morpholin-4-ylphenyl)methyl]benzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)NCc2ccc(N3CCOCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C20H26N2O4S/c1-15-12-19(25-3)13-16(2)20(15)27(23,24)21-14-17-4-6-18(7-5-17)22-8-10-26-11-9-22/h4-7,12-13,21H,8-11,14H2,1-3H3 |
| InChIKey | KYBGEYFZWDVAGL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|