C15H24N2O5S — CID 110417458
4-methoxy-2,6-dimethyl-N-(2-morpholin-4-ylethoxy)benzenesulfonamide (PubChem CID 110417458) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is 4-methoxy-2,6-dimethyl-N-(2-morpholin-4-ylethoxy)benzenesulfonamide.
| Compound Name | 4-methoxy-2,6-dimethyl-N-(2-morpholin-4-ylethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 110417458 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4-methoxy-2,6-dimethyl-N-(2-morpholin-4-ylethoxy)benzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)NOCCN2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C15H24N2O5S/c1-12-10-14(20-3)11-13(2)15(12)23(18,19)16-22-9-6-17-4-7-21-8-5-17/h10-11,16H,4-9H2,1-3H3 |
| InChIKey | LEFUJUOBMNWERW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|