C14H22N2O5S — CID 110643116
3,4-dimethoxy-N-(2-pyrrolidin-1-ylethoxy)benzenesulfonamide (PubChem CID 110643116) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(2-pyrrolidin-1-ylethoxy)benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-(2-pyrrolidin-1-ylethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 110643116 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3,4-dimethoxy-N-(2-pyrrolidin-1-ylethoxy)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NOCCN2CCCC2)cc1OC |
| InChI | InChI=1S/C14H22N2O5S/c1-19-13-6-5-12(11-14(13)20-2)22(17,18)15-21-10-9-16-7-3-4-8-16/h5-6,11,15H,3-4,7-10H2,1-2H3 |
| InChIKey | IYOJXJZUOUSTBW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|