C12H18N2O4S — CID 51335175
N-[(4-methoxyphenyl)methyl]morpholine-4-sulfonamide (PubChem CID 51335175) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]morpholine-4-sulfonamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 51335175 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]morpholine-4-sulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C12H18N2O4S/c1-17-12-4-2-11(3-5-12)10-13-19(15,16)14-6-8-18-9-7-14/h2-5,13H,6-10H2,1H3 |
| InChIKey | PXFNLFLBHCCLFW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |