C16H19N3O5S — CID 55515575
N-[4-[(morpholin-4-ylsulfonylamino)methyl]phenyl]furan-2-carboxamide (PubChem CID 55515575) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is N-[4-[(morpholin-4-ylsulfonylamino)methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(morpholin-4-ylsulfonylamino)methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55515575 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-[4-[(morpholin-4-ylsulfonylamino)methyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(CNS(=O)(=O)N2CCOCC2)cc1)c1ccco1 |
| InChI | InChI=1S/C16H19N3O5S/c20-16(15-2-1-9-24-15)18-14-5-3-13(4-6-14)12-17-25(21,22)19-7-10-23-11-8-19/h1-6,9,17H,7-8,10-12H2,(H,18,20) |
| InChIKey | NOMWHBIXNUJGRA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |