C17H18N2O7S — CID 2391025
[2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] furan-2-carboxylate (PubChem CID 2391025) has the molecular formula C17H18N2O7S and a molecular weight of 394.41 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] furan-2-carboxylate.
| Compound Name | [2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2391025 |
| Molecular Formula | C17H18N2O7S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccco1)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H18N2O7S/c20-16(12-26-17(21)15-2-1-9-25-15)18-13-3-5-14(6-4-13)27(22,23)19-7-10-24-11-8-19/h1-6,9H,7-8,10-12H2,(H,18,20) |
| InChIKey | HFOFJAOIIRAMQL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |