C20H31NO6S — CID 59820154
tert-butyl 2-[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]ethoxy]acetate (PubChem CID 59820154) has the molecular formula C20H31NO6S and a molecular weight of 413.54 g/mol. Its IUPAC name is tert-butyl 2-[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]ethoxy]acetate |
|---|---|
| PubChem CID | 59820154 |
| Molecular Formula | C20H31NO6S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | tert-butyl 2-[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]ethoxy]acetate |
| SMILES | COc1cc(C)c(S(=O)(=O)N(CCOCC(=O)OC(C)(C)C)C2CC2)c(C)c1 |
| InChI | InChI=1S/C20H31NO6S/c1-14-11-17(25-6)12-15(2)19(14)28(23,24)21(16-7-8-16)9-10-26-13-18(22)27-20(3,4)5/h11-12,16H,7-10,13H2,1-6H3 |
| InChIKey | MADXOJIXCSBNGL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|