C22H37NO5S — CID 143657905
tert-butyl 2-[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfinylamino]ethoxy]acetate;ethane (PubChem CID 143657905) has the molecular formula C22H37NO5S and a molecular weight of 427.61 g/mol. Its IUPAC name is tert-butyl 2-[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfinylamino]ethoxy]acetate;ethane.
| Compound Name | tert-butyl 2-[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfinylamino]ethoxy]acetate;ethane |
|---|---|
| PubChem CID | 143657905 |
| Molecular Formula | C22H37NO5S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | tert-butyl 2-[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfinylamino]ethoxy]acetate;ethane |
| SMILES | CC.COc1cc(C)c(S(=O)N(CCOCC(=O)OC(C)(C)C)C2CC2)c(C)c1 |
| InChI | InChI=1S/C20H31NO5S.C2H6/c1-14-11-17(24-6)12-15(2)19(14)27(23)21(16-7-8-16)9-10-25-13-18(22)26-20(3,4)5;1-2/h11-12,16H,7-10,13H2,1-6H3;1-2H3 |
| InChIKey | IAONMRAZPIZNQW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|