C20H33NO6S — CID 91307131
tert-butyl 2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-propan-2-ylamino]ethoxy]acetate (PubChem CID 91307131) has the molecular formula C20H33NO6S and a molecular weight of 415.55 g/mol. Its IUPAC name is tert-butyl 2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-propan-2-ylamino]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-propan-2-ylamino]ethoxy]acetate |
|---|---|
| PubChem CID | 91307131 |
| Molecular Formula | C20H33NO6S |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | tert-butyl 2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-propan-2-ylamino]ethoxy]acetate |
| SMILES | COc1cc(C)c(S(=O)(=O)N(CCOCC(=O)OC(C)(C)C)C(C)C)c(C)c1 |
| InChI | InChI=1S/C20H33NO6S/c1-14(2)21(9-10-26-13-18(22)27-20(5,6)7)28(23,24)19-15(3)11-17(25-8)12-16(19)4/h11-12,14H,9-10,13H2,1-8H3 |
| InChIKey | SYXPUKHVVQYJFN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|