C16H22ClNO5S — CID 143873808
ethyl 2-[2-[(2-chloro-6-methylphenyl)sulfonyl-cyclopropylamino]ethoxy]acetate (PubChem CID 143873808) has the molecular formula C16H22ClNO5S and a molecular weight of 375.87 g/mol. Its IUPAC name is ethyl 2-[2-[(2-chloro-6-methylphenyl)sulfonyl-cyclopropylamino]ethoxy]acetate.
| Compound Name | ethyl 2-[2-[(2-chloro-6-methylphenyl)sulfonyl-cyclopropylamino]ethoxy]acetate |
|---|---|
| PubChem CID | 143873808 |
| Molecular Formula | C16H22ClNO5S |
| Molecular Weight | 375.87 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | ethyl 2-[2-[(2-chloro-6-methylphenyl)sulfonyl-cyclopropylamino]ethoxy]acetate |
| SMILES | CCOC(=O)COCCN(C1CC1)S(=O)(=O)c1c(C)cccc1Cl |
| InChI | InChI=1S/C16H22ClNO5S/c1-3-23-15(19)11-22-10-9-18(13-7-8-13)24(20,21)16-12(2)5-4-6-14(16)17/h4-6,13H,3,7-11H2,1-2H3 |
| InChIKey | YQSMRSVZQKBFGG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.87 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|