C30H38Cl3N3O4S — CID 66703118
2-[2-[cyclopropyl-(2,4,6-trichlorophenyl)sulfonylamino]ethoxy]-N-[4-[phenyl(pyrrolidin-1-yl)methyl]cyclohexyl]acetamide (PubChem CID 66703118) has the molecular formula C30H38Cl3N3O4S and a molecular weight of 643.08 g/mol. Its IUPAC name is 2-[2-[cyclopropyl-(2,4,6-trichlorophenyl)sulfonylamino]ethoxy]-N-[4-[phenyl(pyrrolidin-1-yl)methyl]cyclohexyl]acetamide.
| Compound Name | 2-[2-[cyclopropyl-(2,4,6-trichlorophenyl)sulfonylamino]ethoxy]-N-[4-[phenyl(pyrrolidin-1-yl)methyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 66703118 |
| Molecular Formula | C30H38Cl3N3O4S |
| Molecular Weight | 643.08 g/mol |
| Exact Mass | 641.16 |
| IUPAC Name | 2-[2-[cyclopropyl-(2,4,6-trichlorophenyl)sulfonylamino]ethoxy]-N-[4-[phenyl(pyrrolidin-1-yl)methyl]cyclohexyl]acetamide |
| SMILES | O=C(COCCN(C1CC1)S(=O)(=O)c1c(Cl)cc(Cl)cc1Cl)NC1CCC(C(c2ccccc2)N2CCCC2)CC1 |
| InChI | InChI=1S/C30H38Cl3N3O4S/c31-23-18-26(32)30(27(33)19-23)41(38,39)36(25-12-13-25)16-17-40-20-28(37)34-24-10-8-22(9-11-24)29(35-14-4-5-15-35)21-6-2-1-3-7-21/h1-3,6-7,18-19,22,24-25,29H,4-5,8-17,20H2,(H,34,37) |
| InChIKey | YIGFSFFZMDQYRM-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.08 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|