C31H42Cl3N3O4S — CID 66703418
2-[2-[methyl-(2,4,6-trichlorophenyl)sulfonylamino]ethoxy]-N-[4-(3-phenyl-1-piperidin-1-ylpropyl)cyclohexyl]acetamide (PubChem CID 66703418) has the molecular formula C31H42Cl3N3O4S and a molecular weight of 659.12 g/mol. Its IUPAC name is 2-[2-[methyl-(2,4,6-trichlorophenyl)sulfonylamino]ethoxy]-N-[4-(3-phenyl-1-piperidin-1-ylpropyl)cyclohexyl]acetamide.
| Compound Name | 2-[2-[methyl-(2,4,6-trichlorophenyl)sulfonylamino]ethoxy]-N-[4-(3-phenyl-1-piperidin-1-ylpropyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 66703418 |
| Molecular Formula | C31H42Cl3N3O4S |
| Molecular Weight | 659.12 g/mol |
| Exact Mass | 657.20 |
| IUPAC Name | 2-[2-[methyl-(2,4,6-trichlorophenyl)sulfonylamino]ethoxy]-N-[4-(3-phenyl-1-piperidin-1-ylpropyl)cyclohexyl]acetamide |
| SMILES | CN(CCOCC(=O)NC1CCC(C(CCc2ccccc2)N2CCCCC2)CC1)S(=O)(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C31H42Cl3N3O4S/c1-36(42(39,40)31-27(33)20-25(32)21-28(31)34)18-19-41-22-30(38)35-26-13-11-24(12-14-26)29(37-16-6-3-7-17-37)15-10-23-8-4-2-5-9-23/h2,4-5,8-9,20-21,24,26,29H,3,6-7,10-19,22H2,1H3,(H,35,38) |
| InChIKey | FVNCKRYTDKXKGT-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.12 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|