C36H49N3O5S — CID 87115781
2-[2-[benzyl-(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]ethoxy]-N-[4-[dimethylamino(phenyl)methyl]cyclohexyl]acetamide (PubChem CID 87115781) has the molecular formula C36H49N3O5S and a molecular weight of 635.87 g/mol. Its IUPAC name is 2-[2-[benzyl-(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]ethoxy]-N-[4-[dimethylamino(phenyl)methyl]cyclohexyl]acetamide.
| Compound Name | 2-[2-[benzyl-(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]ethoxy]-N-[4-[dimethylamino(phenyl)methyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 87115781 |
| Molecular Formula | C36H49N3O5S |
| Molecular Weight | 635.87 g/mol |
| Exact Mass | 635.34 |
| IUPAC Name | 2-[2-[benzyl-(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]ethoxy]-N-[4-[dimethylamino(phenyl)methyl]cyclohexyl]acetamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(CCOCC(=O)NC2CCC(C(c3ccccc3)N(C)C)CC2)Cc2ccccc2)c(C)c1C |
| InChI | InChI=1S/C36H49N3O5S/c1-26-23-33(43-6)27(2)28(3)36(26)45(41,42)39(24-29-13-9-7-10-14-29)21-22-44-25-34(40)37-32-19-17-31(18-20-32)35(38(4)5)30-15-11-8-12-16-30/h7-16,23,31-32,35H,17-22,24-25H2,1-6H3,(H,37,40) |
| InChIKey | SBTKEJPDWZAFMU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.87 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|