C26H35F2N3O5S — CID 66703566
2-[2-[[4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl]amino]-2-oxoethoxy]ethyl-(4-fluoro-2-methylphenyl)sulfamic acid (PubChem CID 66703566) has the molecular formula C26H35F2N3O5S and a molecular weight of 539.65 g/mol. Its IUPAC name is 2-[2-[[4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl]amino]-2-oxoethoxy]ethyl-(4-fluoro-2-methylphenyl)sulfamic acid.
| Compound Name | 2-[2-[[4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl]amino]-2-oxoethoxy]ethyl-(4-fluoro-2-methylphenyl)sulfamic acid |
|---|---|
| PubChem CID | 66703566 |
| Molecular Formula | C26H35F2N3O5S |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 2-[2-[[4-[dimethylamino-(3-fluorophenyl)methyl]cyclohexyl]amino]-2-oxoethoxy]ethyl-(4-fluoro-2-methylphenyl)sulfamic acid |
| SMILES | Cc1cc(F)ccc1N(CCOCC(=O)NC1CCC(C(c2cccc(F)c2)N(C)C)CC1)S(=O)(=O)O |
| InChI | InChI=1S/C26H35F2N3O5S/c1-18-15-22(28)9-12-24(18)31(37(33,34)35)13-14-36-17-25(32)29-23-10-7-19(8-11-23)26(30(2)3)20-5-4-6-21(27)16-20/h4-6,9,12,15-16,19,23,26H,7-8,10-11,13-14,17H2,1-3H3,(H,29,32)(H,33,34,35) |
| InChIKey | NIGBJCCMGFDJGJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|